C28H45F3O2 — CID 166920575
(3S,8S,9S,10R,13S,14S,17R)-3-ethyl-10,13-dimethyl-17-[(5S)-6,6,6-trifluoro-5-hydroxy-2-methylhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 166920575) has the molecular formula C28H45F3O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17R)-3-ethyl-10,13-dimethyl-17-[(5S)-6,6,6-trifluoro-5-hydroxy-2-methylhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17R)-3-ethyl-10,13-dimethyl-17-[(5S)-6,6,6-trifluoro-5-hydroxy-2-methylhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 166920575 |
| Molecular Formula | C28H45F3O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17R)-3-ethyl-10,13-dimethyl-17-[(5S)-6,6,6-trifluoro-5-hydroxy-2-methylhexan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(C)(C)CC[C@H](O)C(F)(F)F)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H45F3O2/c1-6-27(33)16-15-25(4)18(17-27)7-8-19-20-9-10-22(26(20,5)14-11-21(19)25)24(2,3)13-12-23(32)28(29,30)31/h7,19-23,32-33H,6,8-17H2,1-5H3/t19-,20-,21-,22+,23-,25-,26-,27-/m0/s1 |
| InChIKey | QYYCEMMYLQSAHJ-JYWLFOLFSA-N |
| XLogP | 7.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|