C31H45FO2 — CID 166789716
(3S,8S,9S,10R,13R,14S,17S)-3-ethyl-17-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 166789716) has the molecular formula C31H45FO2 and a molecular weight of 468.70 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17S)-3-ethyl-17-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17S)-3-ethyl-17-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 166789716 |
| Molecular Formula | C31H45FO2 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17S)-3-ethyl-17-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](CCC[C@@H](O)c5ccc(F)cc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H45FO2/c1-4-31(34)19-18-30(3)23(20-31)10-14-25-26-15-11-22(29(26,2)17-16-27(25)30)6-5-7-28(33)21-8-12-24(32)13-9-21/h8-10,12-13,22,25-28,33-34H,4-7,11,14-20H2,1-3H3/t22-,25-,26-,27-,28+,29+,30-,31-/m0/s1 |
| InChIKey | WTNTUHOWFPDLAY-KWASFTKFSA-N |
| XLogP | 7.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|