C32H47FO2 — CID 134451904
(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5R)-5-(3-fluorophenyl)-5-hydroxypentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134451904) has the molecular formula C32H47FO2 and a molecular weight of 482.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5R)-5-(3-fluorophenyl)-5-hydroxypentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5R)-5-(3-fluorophenyl)-5-hydroxypentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134451904 |
| Molecular Formula | C32H47FO2 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5R)-5-(3-fluorophenyl)-5-hydroxypentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@@H](O)c5cccc(F)c5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H47FO2/c1-5-32(35)18-17-30(3)23(20-32)10-11-25-27-13-12-26(31(27,4)16-15-28(25)30)21(2)9-14-29(34)22-7-6-8-24(33)19-22/h6-8,10,19,21,25-29,34-35H,5,9,11-18,20H2,1-4H3/t21-,25+,26-,27+,28+,29-,30+,31-,32+/m1/s1 |
| InChIKey | IBDSQQOZDICYSE-NBPZMBJASA-N |
| XLogP | 8.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|