C29H50O2 — CID 145230552
ethane;(5R)-5-[(3S)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexanal (PubChem CID 145230552) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is ethane;(5R)-5-[(3S)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexanal.
| Compound Name | ethane;(5R)-5-[(3S)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexanal |
|---|---|
| PubChem CID | 145230552 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | ethane;(5R)-5-[(3S)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]hexanal |
| SMILES | CC.CC[C@]1(O)CCC2(C)C(=CCC3C2CCC2(C)C3CCC2[C@H](C)CCCC=O)C1 |
| InChI | InChI=1S/C27H44O2.C2H6/c1-5-27(29)16-15-25(3)20(18-27)9-10-21-23-12-11-22(19(2)8-6-7-17-28)26(23,4)14-13-24(21)25;1-2/h9,17,19,21-24,29H,5-8,10-16,18H2,1-4H3;1-2H3/t19-,21?,22?,23?,24?,25?,26?,27+;/m1./s1 |
| InChIKey | NLZVGOPLZRIXGN-IZLASXCDSA-N |
| XLogP | 7.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|