C28H47NO3 — CID 145230776
(4R)-4-[(3S,9S,10R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxy-N-methylpentanamide (PubChem CID 145230776) has the molecular formula C28H47NO3 and a molecular weight of 445.69 g/mol. Its IUPAC name is (4R)-4-[(3S,9S,10R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxy-N-methylpentanamide.
| Compound Name | (4R)-4-[(3S,9S,10R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxy-N-methylpentanamide |
|---|---|
| PubChem CID | 145230776 |
| Molecular Formula | C28H47NO3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | (4R)-4-[(3S,9S,10R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxy-N-methylpentanamide |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CCC3[C@@H]4CC[C@H]([C@H](C)CCC(=O)N(C)OC)C4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H47NO3/c1-7-28(31)17-16-26(3)20(18-28)9-10-21-23-12-11-22(27(23,4)15-14-24(21)26)19(2)8-13-25(30)29(5)32-6/h9,19,21-24,31H,7-8,10-18H2,1-6H3/t19-,21?,22-,23+,24+,26+,27?,28+/m1/s1 |
| InChIKey | PRWOAAGYSSHZGT-FUNMVMNDSA-N |
| XLogP | 6.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|