C26H41F2NO — CID 170306022
4-[(8S,9S,10R,13R,14S,17R)-3,3-difluoro-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide (PubChem CID 170306022) has the molecular formula C26H41F2NO and a molecular weight of 421.62 g/mol. Its IUPAC name is 4-[(8S,9S,10R,13R,14S,17R)-3,3-difluoro-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide.
| Compound Name | 4-[(8S,9S,10R,13R,14S,17R)-3,3-difluoro-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 170306022 |
| Molecular Formula | C26H41F2NO |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | 4-[(8S,9S,10R,13R,14S,17R)-3,3-difluoro-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-N,N-dimethylpentanamide |
| SMILES | CC(CCC(=O)N(C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(F)(F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41F2NO/c1-17(6-11-23(30)29(4)5)20-9-10-21-19-8-7-18-16-26(27,28)15-14-24(18,2)22(19)12-13-25(20,21)3/h7,17,19-22H,6,8-16H2,1-5H3/t17?,19-,20+,21-,22-,24-,25+/m0/s1 |
| InChIKey | GHKLSPNCKOJAEN-BSBBDZMBSA-N |
| XLogP | 6.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|