C30H51NO2 — CID 70291014
(8S,9S,10R,13R,14S,17R)-3-hydroxy-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 70291014) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-3-hydroxy-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,10R,13R,14S,17R)-3-hydroxy-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 70291014 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-3-hydroxy-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)(C(=O)N(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H51NO2/c1-20(2)9-8-10-21(3)24-13-14-25-23-12-11-22-19-30(33,27(32)31(6)7)18-17-28(22,4)26(23)15-16-29(24,25)5/h11,20-21,23-26,33H,8-10,12-19H2,1-7H3/t21-,23+,24-,25+,26+,28+,29-,30?/m1/s1 |
| InChIKey | APINSWREWGRQHQ-FAXNVSQMSA-N |
| XLogP | 6.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|