C33H54O2 — CID 69177520
1-[(8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]hex-3-en-1-one (PubChem CID 69177520) has the molecular formula C33H54O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]hex-3-en-1-one.
| Compound Name | 1-[(8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]hex-3-en-1-one |
|---|---|
| PubChem CID | 69177520 |
| Molecular Formula | C33H54O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 1-[(8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]hex-3-en-1-one |
| SMILES | CCC=CCC(=O)C1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C33H54O2/c1-7-8-9-13-30(34)33(35)21-20-31(5)25(22-33)14-15-26-28-17-16-27(24(4)12-10-11-23(2)3)32(28,6)19-18-29(26)31/h8-9,14,23-24,26-29,35H,7,10-13,15-22H2,1-6H3/t24-,26+,27-,28+,29+,31+,32-,33?/m1/s1 |
| InChIKey | OVTUICYVBNMNKC-GYHJTLGSSA-N |
| XLogP | 8.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|