C30H51NO2 — CID 154595708
(2S)-2-amino-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]propan-1-one (PubChem CID 154595708) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is (2S)-2-amino-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]propan-1-one.
| Compound Name | (2S)-2-amino-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]propan-1-one |
|---|---|
| PubChem CID | 154595708 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | (2S)-2-amino-1-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]propan-1-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](O)(C(=O)[C@H](C)N)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H51NO2/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-22-18-30(33,27(32)21(4)31)17-16-28(22,5)26(23)14-15-29(24,25)6/h10,19-21,23-26,33H,7-9,11-18,31H2,1-6H3/t20-,21+,23+,24-,25+,26+,28+,29-,30+/m1/s1 |
| InChIKey | UANLMIDRTOHSNF-CRNUQZJFSA-N |
| XLogP | 6.68 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|