C32H52N2O4 — CID 170306320
methyl 4-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperazine-1-carboxylate (PubChem CID 170306320) has the molecular formula C32H52N2O4 and a molecular weight of 528.78 g/mol. Its IUPAC name is methyl 4-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170306320 |
| Molecular Formula | C32H52N2O4 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.39 |
| IUPAC Name | methyl 4-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]piperazine-1-carboxylate |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(C)CCC(=O)N5CCN(C(=O)OC)CC5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H52N2O4/c1-6-32(37)16-15-30(3)23(21-32)8-9-24-26-11-10-25(31(26,4)14-13-27(24)30)22(2)7-12-28(35)33-17-19-34(20-18-33)29(36)38-5/h8,22,24-27,37H,6-7,9-21H2,1-5H3/t22?,24-,25+,26-,27-,30-,31+,32-/m0/s1 |
| InChIKey | JMIDLZLQUVTWFQ-LVRGORMHSA-N |
| XLogP | 6.03 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|