C30H48N2O3 — CID 170306121
1-(4-acetylpiperazin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one (PubChem CID 170306121) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
|---|---|
| PubChem CID | 170306121 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
| SMILES | CC(=O)N1CCN(C(=O)CCC(C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C30H48N2O3/c1-20(5-10-28(35)32-17-15-31(16-18-32)21(2)33)25-8-9-26-24-7-6-22-19-23(34)11-13-29(22,3)27(24)12-14-30(25,26)4/h6,20,23-27,34H,5,7-19H2,1-4H3/t20?,23-,24-,25+,26-,27-,29-,30+/m0/s1 |
| InChIKey | MHKOPQOQWGNLCX-HOESOAGDSA-N |
| XLogP | 5.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|