C29H47NO3 — CID 170306427
4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3R)-3-hydroxypiperidin-1-yl]pentan-1-one (PubChem CID 170306427) has the molecular formula C29H47NO3 and a molecular weight of 457.70 g/mol. Its IUPAC name is 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3R)-3-hydroxypiperidin-1-yl]pentan-1-one.
| Compound Name | 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3R)-3-hydroxypiperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 170306427 |
| Molecular Formula | C29H47NO3 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3R)-3-hydroxypiperidin-1-yl]pentan-1-one |
| SMILES | CC(CCC(=O)N1CCC[C@@H](O)C1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO3/c1-19(6-11-27(33)30-16-4-5-22(32)18-30)24-9-10-25-23-8-7-20-17-21(31)12-14-28(20,2)26(23)13-15-29(24,25)3/h7,19,21-26,31-32H,4-6,8-18H2,1-3H3/t19?,21-,22+,23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | NXJTUYJMMBKVED-MXLZEFNRSA-N |
| XLogP | 5.33 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|