C32H52N2O3 — CID 169311998
N-[1-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 169311998) has the molecular formula C32H52N2O3 and a molecular weight of 512.78 g/mol. Its IUPAC name is N-[1-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 169311998 |
| Molecular Formula | C32H52N2O3 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.40 |
| IUPAC Name | N-[1-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCN(C(=O)CC[C@@H](C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C32H52N2O3/c1-21(6-11-30(37)34-18-14-24(15-19-34)33(5)22(2)35)27-9-10-28-26-8-7-23-20-25(36)12-16-31(23,3)29(26)13-17-32(27,28)4/h7,21,24-29,36H,6,8-20H2,1-5H3/t21-,25+,26+,27-,28+,29+,31+,32-/m1/s1 |
| InChIKey | WKQVLMGFKVWNSF-KNLNLFKVSA-N |
| XLogP | 5.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|