C29H47NO2 — CID 139376738
(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-piperidin-1-ylpentan-1-one (PubChem CID 139376738) has the molecular formula C29H47NO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-piperidin-1-ylpentan-1-one.
| Compound Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-piperidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 139376738 |
| Molecular Formula | C29H47NO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.36 |
| IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-piperidin-1-ylpentan-1-one |
| SMILES | C[C@H](CCC(=O)N1CCCCC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47NO2/c1-20(7-12-27(32)30-17-5-4-6-18-30)24-10-11-25-23-9-8-21-19-22(31)13-15-28(21,2)26(23)14-16-29(24,25)3/h8,20,22-26,31H,4-7,9-19H2,1-3H3/t20-,22+,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | HQEOOEBPIAQBCV-OHPSOFBHSA-N |
| XLogP | 6.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|