C30H48N2O3 — CID 170306313
1-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-N-methylpyrrolidine-3-carboxamide (PubChem CID 170306313) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is 1-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-N-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-N-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170306313 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | 1-[4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-N-methylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)CCC(C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)C1 |
| InChI | InChI=1S/C30H48N2O3/c1-19(5-10-27(34)32-16-13-20(18-32)28(35)31-4)24-8-9-25-23-7-6-21-17-22(33)11-14-29(21,2)26(23)12-15-30(24,25)3/h6,19-20,22-26,33H,5,7-18H2,1-4H3,(H,31,35)/t19?,20?,22-,23-,24+,25-,26-,29-,30+/m0/s1 |
| InChIKey | ZTLWFPRUAWDKQH-QYUPMBCSSA-N |
| XLogP | 4.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|