C34H49NO2 — CID 169312301
(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3S)-3-phenylpyrrolidin-1-yl]pentan-1-one (PubChem CID 169312301) has the molecular formula C34H49NO2 and a molecular weight of 503.77 g/mol. Its IUPAC name is (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3S)-3-phenylpyrrolidin-1-yl]pentan-1-one.
| Compound Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3S)-3-phenylpyrrolidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 169312301 |
| Molecular Formula | C34H49NO2 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.38 |
| IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-[(3S)-3-phenylpyrrolidin-1-yl]pentan-1-one |
| SMILES | C[C@H](CCC(=O)N1CC[C@@H](c2ccccc2)C1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H49NO2/c1-23(9-14-32(37)35-20-17-25(22-35)24-7-5-4-6-8-24)29-12-13-30-28-11-10-26-21-27(36)15-18-33(26,2)31(28)16-19-34(29,30)3/h4-8,10,23,25,27-31,36H,9,11-22H2,1-3H3/t23-,25-,27+,28+,29-,30+,31+,33+,34-/m1/s1 |
| InChIKey | FWWZEHKSRVWMDP-PYTBKUEESA-N |
| XLogP | 7.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|