C29H46O2 — CID 144552019
(3R,10R,13S,17R)-3-ethyl-17-[(3R)-6-hydroxy-6-methylhept-1-yn-3-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 144552019) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (3R,10R,13S,17R)-3-ethyl-17-[(3R)-6-hydroxy-6-methylhept-1-yn-3-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10R,13S,17R)-3-ethyl-17-[(3R)-6-hydroxy-6-methylhept-1-yn-3-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144552019 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (3R,10R,13S,17R)-3-ethyl-17-[(3R)-6-hydroxy-6-methylhept-1-yn-3-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C#C[C@H](CCC(C)(C)O)[C@H]1CCC2C3CC=C4C[C@@](O)(CC)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H46O2/c1-7-20(13-15-26(3,4)30)23-11-12-24-22-10-9-21-19-29(31,8-2)18-17-27(21,5)25(22)14-16-28(23,24)6/h1,9,20,22-25,30-31H,8,10-19H2,2-6H3/t20-,22?,23-,24?,25?,27+,28-,29-/m1/s1 |
| InChIKey | IGINFDCHHCDEBF-QCBXNFMPSA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|