C28H44O3 — CID 134455006
(3S,8S,9S,10R,13S,14S,17R)-17-[(1S)-1-[(2R)-1,6-dioxaspiro[3.3]heptan-2-yl]ethyl]-3-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134455006) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17R)-17-[(1S)-1-[(2R)-1,6-dioxaspiro[3.3]heptan-2-yl]ethyl]-3-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17R)-17-[(1S)-1-[(2R)-1,6-dioxaspiro[3.3]heptan-2-yl]ethyl]-3-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134455006 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17R)-17-[(1S)-1-[(2R)-1,6-dioxaspiro[3.3]heptan-2-yl]ethyl]-3-ethyl-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)[C@H]5CC6(COC6)O5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H44O3/c1-5-27(29)13-12-25(3)19(14-27)6-7-20-22-9-8-21(26(22,4)11-10-23(20)25)18(2)24-15-28(31-24)16-30-17-28/h6,18,20-24,29H,5,7-17H2,1-4H3/t18-,20-,21+,22-,23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | OOJLHFJQKRKMNA-ZQZWCTIGSA-N |
| XLogP | 5.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|