C31H52O3 — CID 152907352
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-hydroxy-5-(oxan-4-yl)hexan-2-yl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 152907352) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-hydroxy-5-(oxan-4-yl)hexan-2-yl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-hydroxy-5-(oxan-4-yl)hexan-2-yl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 152907352 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-hydroxy-5-(oxan-4-yl)hexan-2-yl]-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CC[C@@](C)(O)C1CCOCC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O3/c1-21(10-15-31(5,33)22-12-18-34-19-13-22)25-8-9-26-24-7-6-23-20-28(2,32)16-17-29(23,3)27(24)11-14-30(25,26)4/h6,21-22,24-27,32-33H,7-20H2,1-5H3/t21-,24+,25-,26+,27+,28+,29+,30-,31-/m1/s1 |
| InChIKey | UGMXFIPKQRQGQG-XDAWFLGKSA-N |
| XLogP | 6.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|