C28H46O3 — CID 163559668
(3S)-3-[(3R)-3-[(3S,8S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol (PubChem CID 163559668) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-[(3S,8S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol.
| Compound Name | (3S)-3-[(3R)-3-[(3S,8S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
|---|---|
| PubChem CID | 163559668 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (3S)-3-[(3R)-3-[(3S,8S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
| SMILES | C[C@H](CC[C@]1(O)CCOC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C28H46O3/c1-19(9-12-28(30)15-16-31-18-28)22-7-8-23-21-6-5-20-17-25(2,29)13-14-26(20,3)24(21)10-11-27(22,23)4/h5,19,21-24,29-30H,6-18H2,1-4H3/t19-,21+,22-,23+,24?,25+,26+,27-,28+/m1/s1 |
| InChIKey | FQDGPPKWXQFIEQ-FSXRMNRXSA-N |
| XLogP | 5.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|