C28H44O3 — CID 166170922
(3S)-3-[(3R)-3-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol (PubChem CID 166170922) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol.
| Compound Name | (3S)-3-[(3R)-3-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
|---|---|
| PubChem CID | 166170922 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (3S)-3-[(3R)-3-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,17-decahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
| SMILES | C[C@H](CC[C@]1(O)CCOC1)[C@H]1C=C[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H44O3/c1-19(9-12-28(30)15-16-31-18-28)22-7-8-23-21-6-5-20-17-25(2,29)13-14-26(20,3)24(21)10-11-27(22,23)4/h5,7-8,19,21-24,29-30H,6,9-18H2,1-4H3/t19-,21+,22-,23+,24+,25+,26+,27-,28+/m1/s1 |
| InChIKey | WLFJKGVRHVCHGA-LVSAPHKCSA-N |
| XLogP | 5.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|