C34H58O2 — CID 163939903
(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-4-(4-ethyl-1-hydroxy-4-methylcyclohexyl)butan-2-yl]-3,10,13,16-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 163939903) has the molecular formula C34H58O2 and a molecular weight of 498.84 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-4-(4-ethyl-1-hydroxy-4-methylcyclohexyl)butan-2-yl]-3,10,13,16-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-4-(4-ethyl-1-hydroxy-4-methylcyclohexyl)butan-2-yl]-3,10,13,16-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163939903 |
| Molecular Formula | C34H58O2 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.44 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-4-(4-ethyl-1-hydroxy-4-methylcyclohexyl)butan-2-yl]-3,10,13,16-tetramethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC1(C)CCC(O)(CC[C@@H](C)[C@H]2C(C)C[C@H]3[C@@H]4CC=C5C[C@@](C)(O)CC[C@]5(C)[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C34H58O2/c1-8-30(4)15-19-34(36,20-16-30)14-11-23(2)29-24(3)21-28-26-10-9-25-22-31(5,35)17-18-32(25,6)27(26)12-13-33(28,29)7/h9,23-24,26-29,35-36H,8,10-22H2,1-7H3/t23-,24?,26-,27+,28+,29+,30?,31+,32+,33+,34?/m1/s1 |
| InChIKey | VBTLYVTYORKBJV-FNUKGOJJSA-N |
| XLogP | 8.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|