C27H41F3O3 — CID 166880158
(3S)-3-[3-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol (PubChem CID 166880158) has the molecular formula C27H41F3O3 and a molecular weight of 470.62 g/mol. Its IUPAC name is (3S)-3-[3-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol.
| Compound Name | (3S)-3-[3-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol |
|---|---|
| PubChem CID | 166880158 |
| Molecular Formula | C27H41F3O3 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (3S)-3-[3-[(3S,8S,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@](O)(C(F)(F)F)CC[C@@]43C)[C@@H]1CC[C@@H]2CCC[C@]1(O)CCOC1 |
| InChI | InChI=1S/C27H41F3O3/c1-23-11-9-22-20(7-5-19-16-26(32,27(28,29)30)13-12-24(19,22)2)21(23)8-6-18(23)4-3-10-25(31)14-15-33-17-25/h5,18,20-22,31-32H,3-4,6-17H2,1-2H3/t18-,20-,21-,22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | JHWZGKNOHJQWOT-NXDQBNBWSA-N |
| XLogP | 6.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|