C24H38F2O — CID 144728545
(13R,14S)-17-(3,3-difluoropentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 144728545) has the molecular formula C24H38F2O and a molecular weight of 380.56 g/mol. Its IUPAC name is (13R,14S)-17-(3,3-difluoropentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (13R,14S)-17-(3,3-difluoropentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144728545 |
| Molecular Formula | C24H38F2O |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (13R,14S)-17-(3,3-difluoropentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(F)(F)CCC1CC[C@H]2C3CC=C4CC(O)CCC4(C)C3CC[C@]12C |
| InChI | InChI=1S/C24H38F2O/c1-4-24(25,26)14-9-16-6-8-20-19-7-5-17-15-18(27)10-12-23(17,3)21(19)11-13-22(16,20)2/h5,16,18-21,27H,4,6-15H2,1-3H3/t16?,18?,19?,20-,21?,22+,23?/m0/s1 |
| InChIKey | NTORFSCOQSEKLP-NGTHKKJHSA-N |
| XLogP | 6.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|