C35H52O3 — CID 134455185
[(2S,3R)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-yl] benzoate (PubChem CID 134455185) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [(2S,3R)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-yl] benzoate.
| Compound Name | [(2S,3R)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-yl] benzoate |
|---|---|
| PubChem CID | 134455185 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [(2S,3R)-2-[(3S,8S,9S,10R,13S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-yl] benzoate |
| SMILES | CC(C)CC[C@@H](OC(=O)c1ccccc1)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H52O3/c1-23(2)12-17-31(38-32(36)25-10-8-7-9-11-25)24(3)28-15-16-29-27-14-13-26-22-33(4,37)20-21-34(26,5)30(27)18-19-35(28,29)6/h7-11,13,23-24,27-31,37H,12,14-22H2,1-6H3/t24-,27-,28+,29-,30-,31+,33-,34-,35+/m0/s1 |
| InChIKey | HQPXUVHTBXZDJX-OFNIBFNLSA-N |
| XLogP | 8.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|