C37H58O8 — CID 59351091
5-[[17-[(2S)-3-(4-carboxybutanoyloxy)-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-oxopentanoic acid (PubChem CID 59351091) has the molecular formula C37H58O8 and a molecular weight of 630.86 g/mol. Its IUPAC name is 5-[[17-[(2S)-3-(4-carboxybutanoyloxy)-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-oxopentanoic acid.
| Compound Name | 5-[[17-[(2S)-3-(4-carboxybutanoyloxy)-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 59351091 |
| Molecular Formula | C37H58O8 |
| Molecular Weight | 630.86 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 5-[[17-[(2S)-3-(4-carboxybutanoyloxy)-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-oxopentanoic acid |
| SMILES | CC(C)CCC(OC(=O)CCCC(=O)O)[C@@H](C)C1CCC2C3CC=C4CC(OC(=O)CCCC(=O)O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C37H58O8/c1-23(2)12-17-31(45-35(43)11-7-9-33(40)41)24(3)28-15-16-29-27-14-13-25-22-26(44-34(42)10-6-8-32(38)39)18-20-36(25,4)30(27)19-21-37(28,29)5/h13,23-24,26-31H,6-12,14-22H2,1-5H3,(H,38,39)(H,40,41)/t24-,26?,27?,28?,29?,30?,31?,36?,37?/m0/s1 |
| InChIKey | FKFZCZZDHIGYSZ-QDENFXQCSA-N |
| XLogP | 7.97 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.86 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|