C37H60O5 — CID 69261904
10-[[(10R,13S,17R)-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-10-oxodecanoic acid (PubChem CID 69261904) has the molecular formula C37H60O5 and a molecular weight of 584.88 g/mol. Its IUPAC name is 10-[[(10R,13S,17R)-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-10-oxodecanoic acid.
| Compound Name | 10-[[(10R,13S,17R)-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 69261904 |
| Molecular Formula | C37H60O5 |
| Molecular Weight | 584.88 g/mol |
| Exact Mass | 584.44 |
| IUPAC Name | 10-[[(10R,13S,17R)-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-10-oxodecanoic acid |
| SMILES | CC(C)CCC(=O)[C@@H](C)[C@H]1CCC2C3CC=C4CC(OC(=O)CCCCCCCCC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C37H60O5/c1-25(2)14-19-33(38)26(3)30-17-18-31-29-16-15-27-24-28(20-22-36(27,4)32(29)21-23-37(30,31)5)42-35(41)13-11-9-7-6-8-10-12-34(39)40/h15,25-26,28-32H,6-14,16-24H2,1-5H3,(H,39,40)/t26-,28?,29?,30+,31?,32?,36-,37+/m0/s1 |
| InChIKey | XCKWXJYOJWFDAA-IJMNRTEISA-N |
| XLogP | 9.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.88 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|