C29H42OS — CID 145230631
(3S)-3,10,13-trimethyl-17-[(2S)-1-phenylsulfanylpropan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 145230631) has the molecular formula C29H42OS and a molecular weight of 438.72 g/mol. Its IUPAC name is (3S)-3,10,13-trimethyl-17-[(2S)-1-phenylsulfanylpropan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-3,10,13-trimethyl-17-[(2S)-1-phenylsulfanylpropan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145230631 |
| Molecular Formula | C29H42OS |
| Molecular Weight | 438.72 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (3S)-3,10,13-trimethyl-17-[(2S)-1-phenylsulfanylpropan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CSc1ccccc1)C1CCC2C3CC=C4C[C@@](C)(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C29H42OS/c1-20(19-31-22-8-6-5-7-9-22)24-12-13-25-23-11-10-21-18-27(2,30)16-17-28(21,3)26(23)14-15-29(24,25)4/h5-10,20,23-26,30H,11-19H2,1-4H3/t20-,23?,24?,25?,26?,27+,28?,29?/m1/s1 |
| InChIKey | GNWKWVDRJUMCTH-KLRGDKEOSA-N |
| XLogP | 7.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|