C21H34O2 — CID 144728637
(3S,8R,13S)-3-hydroxy-3,10,13-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one;methane (PubChem CID 144728637) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (3S,8R,13S)-3-hydroxy-3,10,13-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one;methane.
| Compound Name | (3S,8R,13S)-3-hydroxy-3,10,13-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one;methane |
|---|---|
| PubChem CID | 144728637 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (3S,8R,13S)-3-hydroxy-3,10,13-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one;methane |
| SMILES | C.CC12CC[C@](C)(O)CC1=CC[C@@H]1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C20H30O2.CH4/c1-18(22)10-11-19(2)13(12-18)4-5-14-15-6-7-17(21)20(15,3)9-8-16(14)19;/h4,14-16,22H,5-12H2,1-3H3;1H4/t14-,15?,16?,18-,19?,20-;/m0./s1 |
| InChIKey | XMTVPCRGSRYPEK-JMPGVGSOSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|