C26H41NO3 — CID 11538920
3-hydroxy-3-[[(4-hydroxycyclohexyl)amino]methyl]-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11538920) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is 3-hydroxy-3-[[(4-hydroxycyclohexyl)amino]methyl]-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 3-hydroxy-3-[[(4-hydroxycyclohexyl)amino]methyl]-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11538920 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | 3-hydroxy-3-[[(4-hydroxycyclohexyl)amino]methyl]-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C(CC=C4CC(O)(CNC5CCC(O)CC5)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C26H41NO3/c1-24-13-14-26(30,16-27-18-4-6-19(28)7-5-18)15-17(24)3-8-20-21-9-10-23(29)25(21,2)12-11-22(20)24/h3,18-22,27-28,30H,4-16H2,1-2H3 |
| InChIKey | MDAWZMJGIYNMOS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|