C23H32O5 — CID 67639981
[(8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67639981) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67639981 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-3-acetyloxy-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1(OC(C)=O)CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H32O5/c1-14(24)27-23(28-15(2)25)12-11-21(3)16(13-23)5-6-17-18-7-8-20(26)22(18,4)10-9-19(17)21/h5,17-19H,6-13H2,1-4H3/t17-,18-,19-,21-,22-/m0/s1 |
| InChIKey | KYLFSIORBFGJFA-PAPPXSOASA-N |
| XLogP | 4.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|