C25H42O3Si — CID 90025916
(3R,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 90025916) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90025916 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(O)CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H42O3Si/c1-22(2,3)29(6,7)28-25(27)15-14-23(4)17(16-25)8-9-18-19-10-11-21(26)24(19,5)13-12-20(18)23/h8,18-20,27H,9-16H2,1-7H3/t18-,19-,20-,23-,24-,25+/m0/s1 |
| InChIKey | BVRSWZUNYNGKNR-GWSRRZGTSA-N |
| XLogP | 6.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|