C22H38O — CID 171643159
2-[(3S,5R,8R,10S)-3-ethyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 171643159) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 2-[(3S,5R,8R,10S)-3-ethyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 2-[(3S,5R,8R,10S)-3-ethyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 171643159 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 2-[(3S,5R,8R,10S)-3-ethyl-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | CC[C@H]1CC[C@@H]2C3CCC4(C)C(CCO)CCC4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C22H38O/c1-3-15-4-7-18-16(14-15)5-8-20-19(18)10-12-22(2)17(11-13-23)6-9-21(20)22/h15-21,23H,3-14H2,1-2H3/t15-,16+,17?,18-,19?,20+,21?,22?/m0/s1 |
| InChIKey | RKQFGZSNHGUDFX-BWHFKECGSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |