C24H42O — CID 171643133
(3S,13R)-3-ethyl-17-(3-methoxypropyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene (PubChem CID 171643133) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is (3S,13R)-3-ethyl-17-(3-methoxypropyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,13R)-3-ethyl-17-(3-methoxypropyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 171643133 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | (3S,13R)-3-ethyl-17-(3-methoxypropyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CCC2C(CCC3C2CC[C@]2(C)C(CCCOC)CCC32)C1 |
| InChI | InChI=1S/C24H42O/c1-4-17-7-10-20-18(16-17)8-11-22-21(20)13-14-24(2)19(6-5-15-25-3)9-12-23(22)24/h17-23H,4-16H2,1-3H3/t17-,18?,19?,20?,21?,22?,23?,24+/m0/s1 |
| InChIKey | FQMRFUJWWBQYME-JCTMEFFISA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|