C22H36O2 — CID 171643150
(5R,8R,10S,13R)-17-(3-methoxypropyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 171643150) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (5R,8R,10S,13R)-17-(3-methoxypropyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,8R,10S,13R)-17-(3-methoxypropyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 171643150 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (5R,8R,10S,13R)-17-(3-methoxypropyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COCCCC1CCC2[C@@H]3CC[C@@H]4CC(=O)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C22H36O2/c1-22-12-11-19-18-9-7-17(23)14-15(18)5-8-20(19)21(22)10-6-16(22)4-3-13-24-2/h15-16,18-21H,3-14H2,1-2H3/t15-,16?,18+,19?,20-,21?,22-/m1/s1 |
| InChIKey | DGBZCZRPUFRUAD-LEXSOUNUSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|