C18H30O2 — CID 145130065
(8R,9R,10S,13S)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,17-dione;molecular hydrogen (PubChem CID 145130065) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (8R,9R,10S,13S)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,17-dione;molecular hydrogen.
| Compound Name | (8R,9R,10S,13S)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,17-dione;molecular hydrogen |
|---|---|
| PubChem CID | 145130065 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (8R,9R,10S,13S)-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,17-dione;molecular hydrogen |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CCC(=O)CC4CC[C@H]3C1CCC2=O.[H][H].[H][H] |
| InChI | InChI=1S/C18H26O2.2H2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;;/h11,13-16H,2-10H2,1H3;2*1H/t11?,13-,14+,15+,16?,18-;;/m0../s1 |
| InChIKey | DKZAZIBALRUURR-OGZVLBCNSA-N |
| XLogP | 4.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |