C18H24O2 — CID 164708089
CID 164708089 (PubChem CID 164708089) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol.
| Compound Name | CID 164708089 |
|---|---|
| PubChem CID | 164708089 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | — |
| SMILES | [CH][C@]12CC[C@H]3[C@@H](CC[C@@H]4CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h1,11,13-16H,2-10H2/t11-,13+,14-,15-,16+,18+/m1/s1 |
| InChIKey | HWZMIYLMZHAUPQ-ARAASWILSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |