C19H26O2 — CID 164708102
CID 164708102 (PubChem CID 164708102) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol.
| Compound Name | CID 164708102 |
|---|---|
| PubChem CID | 164708102 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | — |
| SMILES | [CH][C@]12CC[C@H]3[C@@H](CC[C@@H]4CC(=O)CC[C@@H]43)[C@@H]1CCCC2=O |
| InChI | InChI=1S/C19H26O2/c1-19-10-9-15-14-8-6-13(20)11-12(14)5-7-16(15)17(19)3-2-4-18(19)21/h1,12,14-17H,2-11H2/t12-,14+,15-,16-,17+,19+/m1/s1 |
| InChIKey | RDZWACCAJADFJB-FWXJYBMHSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |