C13H20O — CID 67931978
(9aR,9bS)-1,2,3,3a,4,5,5a,6,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-7-one (PubChem CID 67931978) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (9aR,9bS)-1,2,3,3a,4,5,5a,6,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-7-one.
| Compound Name | (9aR,9bS)-1,2,3,3a,4,5,5a,6,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 67931978 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (9aR,9bS)-1,2,3,3a,4,5,5a,6,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-7-one |
| SMILES | O=C1CC[C@@H]2C(CCC3CCC[C@@H]32)C1 |
| InChI | InChI=1S/C13H20O/c14-11-6-7-13-10(8-11)5-4-9-2-1-3-12(9)13/h9-10,12-13H,1-8H2/t9?,10?,12-,13+/m0/s1 |
| InChIKey | VRIWVJLDNSHRSE-XYJRBWASSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |