C20H32O — CID 163383803
8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-one (PubChem CID 163383803) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-one.
| Compound Name | 8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-one |
|---|---|
| PubChem CID | 163383803 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-one |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(=O)CCCC32)C1 |
| InChI | InChI=1S/C20H32O/c1-13-6-8-15-14(12-13)7-9-17-16(15)10-11-20(2)18(17)4-3-5-19(20)21/h13-18H,3-12H2,1-2H3 |
| InChIKey | KQIUELYFSQCXDD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |