C20H33NO — CID 77460337
3-(dimethylamino)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 77460337) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-(dimethylamino)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 3-(dimethylamino)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 77460337 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-(dimethylamino)-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(C)C1CCC2C(CCC3C2CCC2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C20H33NO/c1-20-11-10-16-15-7-5-14(21(2)3)12-13(15)4-6-17(16)18(20)8-9-19(20)22/h13-18H,4-12H2,1-3H3 |
| InChIKey | DWPBDIGMLHQFHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |