C21H34O — CID 155752586
ethane;13-methyl-3-methylidene-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 155752586) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is ethane;13-methyl-3-methylidene-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | ethane;13-methyl-3-methylidene-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 155752586 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | ethane;13-methyl-3-methylidene-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=C1CCC2C(CCC3C2CCC2(C)C(=O)CCC32)C1.CC |
| InChI | InChI=1S/C19H28O.C2H6/c1-12-3-5-14-13(11-12)4-6-16-15(14)9-10-19(2)17(16)7-8-18(19)20;1-2/h13-17H,1,3-11H2,2H3;1-2H3 |
| InChIKey | OOQBCXSHFWHXHX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|