C24H38O3 — CID 167557231
ethyl (1R,2S,8S,11R,12S,15R,17R)-8,15-dimethyl-7-oxotetracyclo[9.8.0.02,8.012,17]nonadecane-6-carboxylate (PubChem CID 167557231) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethyl (1R,2S,8S,11R,12S,15R,17R)-8,15-dimethyl-7-oxotetracyclo[9.8.0.02,8.012,17]nonadecane-6-carboxylate.
| Compound Name | ethyl (1R,2S,8S,11R,12S,15R,17R)-8,15-dimethyl-7-oxotetracyclo[9.8.0.02,8.012,17]nonadecane-6-carboxylate |
|---|---|
| PubChem CID | 167557231 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | ethyl (1R,2S,8S,11R,12S,15R,17R)-8,15-dimethyl-7-oxotetracyclo[9.8.0.02,8.012,17]nonadecane-6-carboxylate |
| SMILES | CCOC(=O)C1CCC[C@H]2[C@@H]3CC[C@@H]4C[C@H](C)CC[C@@H]4[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C24H38O3/c1-4-27-23(26)20-6-5-7-21-19-11-9-16-14-15(2)8-10-17(16)18(19)12-13-24(21,3)22(20)25/h15-21H,4-14H2,1-3H3/t15-,16-,17+,18-,19-,20?,21+,24+/m1/s1 |
| InChIKey | LZMOLFOXYVKBPD-JZXNCZDNSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|