C24H42 — CID 144732752
(5R,8R,9R,10S,13S,14S,17E)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene;ethane (PubChem CID 144732752) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is (5R,8R,9R,10S,13S,14S,17E)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene;ethane.
| Compound Name | (5R,8R,9R,10S,13S,14S,17E)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene;ethane |
|---|---|
| PubChem CID | 144732752 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | (5R,8R,9R,10S,13S,14S,17E)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene;ethane |
| SMILES | CC.CC/C=C1\CC[C@H]2[C@@H]3CC[C@@H]4CC(C)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H36.C2H6/c1-4-5-17-8-11-21-20-10-7-16-14-15(2)6-9-18(16)19(20)12-13-22(17,21)3;1-2/h5,15-16,18-21H,4,6-14H2,1-3H3;1-2H3/b17-5+;/t15?,16-,18+,19-,20-,21+,22-;/m1./s1 |
| InChIKey | MBBKGIYRQMKUIF-RXUQTUETSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|