C22H36 — CID 145065439
(3S,8R,10S,13S,17Z)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 145065439) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (3S,8R,10S,13S,17Z)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8R,10S,13S,17Z)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145065439 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (3S,8R,10S,13S,17Z)-3,13-dimethyl-17-propylidene-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC/C=C1/CCC2[C@@H]3CCC4C[C@@H](C)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C22H36/c1-4-5-17-8-11-21-20-10-7-16-14-15(2)6-9-18(16)19(20)12-13-22(17,21)3/h5,15-16,18-21H,4,6-14H2,1-3H3/b17-5-/t15-,16?,18-,19?,20+,21?,22+/m0/s1 |
| InChIKey | IITUJWQQDDILFD-KNESQYSFSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|