C22H36O2 — CID 158046176
(5S,8R,9R,10S,13S,14S)-17-ethylidene-3,3-dimethoxy-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 158046176) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (5S,8R,9R,10S,13S,14S)-17-ethylidene-3,3-dimethoxy-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (5S,8R,9R,10S,13S,14S)-17-ethylidene-3,3-dimethoxy-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 158046176 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (5S,8R,9R,10S,13S,14S)-17-ethylidene-3,3-dimethoxy-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CC=C1CC[C@H]2[C@@H]3CC[C@H]4CC(OC)(OC)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H36O2/c1-5-16-7-9-20-19-8-6-15-14-22(23-3,24-4)13-11-17(15)18(19)10-12-21(16,20)2/h5,15,17-20H,6-14H2,1-4H3/t15-,17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | SPYAVZSOWZLMMA-IRZCZHAHSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|