C21H32O — CID 144732573
(3R,5R,8R,9R,13S,14S,17Z)-17-ethylidene-13-methylspiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane] (PubChem CID 144732573) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (3R,5R,8R,9R,13S,14S,17Z)-17-ethylidene-13-methylspiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane].
| Compound Name | (3R,5R,8R,9R,13S,14S,17Z)-17-ethylidene-13-methylspiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane] |
|---|---|
| PubChem CID | 144732573 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (3R,5R,8R,9R,13S,14S,17Z)-17-ethylidene-13-methylspiro[1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,2'-oxirane] |
| SMILES | C/C=C1/CC[C@H]2[C@@H]3CC[C@@H]4C[C@]5(CCC4[C@H]3CC[C@]12C)CO5 |
| InChI | InChI=1S/C21H32O/c1-3-15-5-7-19-18-6-4-14-12-21(13-22-21)11-9-16(14)17(18)8-10-20(15,19)2/h3,14,16-19H,4-13H2,1-2H3/b15-3-/t14-,16?,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | BNGKGFRWCKKJKT-LROGVUDVSA-N |
| XLogP | 5.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|