C21H31F3 — CID 171642582
(3S,5R,8R,10S,13S,17Z)-17-ethylidene-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 171642582) has the molecular formula C21H31F3 and a molecular weight of 340.47 g/mol. Its IUPAC name is (3S,5R,8R,10S,13S,17Z)-17-ethylidene-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,5R,8R,10S,13S,17Z)-17-ethylidene-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 171642582 |
| Molecular Formula | C21H31F3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (3S,5R,8R,10S,13S,17Z)-17-ethylidene-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C/C=C1/CCC2[C@@H]3CC[C@@H]4C[C@@H](C(F)(F)F)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C21H31F3/c1-3-14-6-9-19-18-7-4-13-12-15(21(22,23)24)5-8-16(13)17(18)10-11-20(14,19)2/h3,13,15-19H,4-12H2,1-2H3/b14-3-/t13-,15+,16+,17?,18-,19?,20-/m1/s1 |
| InChIKey | NCLVQELSIZUBAY-PMEBETESSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|