C21H34O3S — CID 155385033
[(3S,5R,8R,9R,10S,13S,14S,17E)-17-ethylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 155385033) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is [(3S,5R,8R,9R,10S,13S,14S,17E)-17-ethylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(3S,5R,8R,9R,10S,13S,14S,17E)-17-ethylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 155385033 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(3S,5R,8R,9R,10S,13S,14S,17E)-17-ethylidene-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | C/C=C1\CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](OS(C)(=O)=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34O3S/c1-4-15-6-10-20-19-8-5-14-13-16(24-25(3,22)23)7-9-17(14)18(19)11-12-21(15,20)2/h4,14,16-20H,5-13H2,1-3H3/b15-4+/t14-,16+,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | PIXYDMBGDZWETG-OMPCHKTCSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|