C21H32F2O — CID 159039763
(3R,10S,13S)-3-(difluoromethyl)-17-ethylidene-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 159039763) has the molecular formula C21H32F2O and a molecular weight of 338.48 g/mol. Its IUPAC name is (3R,10S,13S)-3-(difluoromethyl)-17-ethylidene-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10S,13S)-3-(difluoromethyl)-17-ethylidene-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 159039763 |
| Molecular Formula | C21H32F2O |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (3R,10S,13S)-3-(difluoromethyl)-17-ethylidene-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC=C1CCC2C3CCC4C[C@@](O)(C(F)F)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C21H32F2O/c1-3-14-5-7-18-17-6-4-13-12-21(24,19(22)23)11-9-15(13)16(17)8-10-20(14,18)2/h3,13,15-19,24H,4-12H2,1-2H3/t13?,15-,16?,17?,18?,20+,21+/m0/s1 |
| InChIKey | YWDCAMAUGQJCDI-QCRHWBNVSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|